C40H74O4 — CID 58948047
[(2S)-2-octadec-9-enoyloxybutyl] octadec-9-enoate (PubChem CID 58948047) has the molecular formula C40H74O4 and a molecular weight of 619.03 g/mol. Its IUPAC name is [(2S)-2-octadec-9-enoyloxybutyl] octadec-9-enoate.
| Compound Name | [(2S)-2-octadec-9-enoyloxybutyl] octadec-9-enoate |
|---|---|
| PubChem CID | 58948047 |
| Molecular Formula | C40H74O4 |
| Molecular Weight | 619.03 g/mol |
| Exact Mass | 618.56 |
| IUPAC Name | [(2S)-2-octadec-9-enoyloxybutyl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC[C@H](CC)OC(=O)CCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C40H74O4/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39(41)43-37-38(6-3)44-40(42)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2/h19-22,38H,4-18,23-37H2,1-3H3/t38-/m0/s1 |
| InChIKey | LQKDVQLOTZHGNG-LHEWISCISA-N |
| XLogP | 12.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.03 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|