C39H39NO4P+ — CID 58948112
[4-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyloxymethyl]phenyl]phenyl]-triphenylphosphanium (PubChem CID 58948112) has the molecular formula C39H39NO4P+ and a molecular weight of 616.72 g/mol. Its IUPAC name is [4-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyloxymethyl]phenyl]phenyl]-triphenylphosphanium.
| Compound Name | [4-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyloxymethyl]phenyl]phenyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 58948112 |
| Molecular Formula | C39H39NO4P+ |
| Molecular Weight | 616.72 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | [4-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyloxymethyl]phenyl]phenyl]-triphenylphosphanium |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)OCc1ccc(-c2ccc([P+](c3ccccc3)(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C39H38NO4P/c1-29(40-38(42)44-39(2,3)4)37(41)43-28-30-20-22-31(23-21-30)32-24-26-36(27-25-32)45(33-14-8-5-9-15-33,34-16-10-6-11-17-34)35-18-12-7-13-19-35/h5-27,29H,28H2,1-4H3/p+1 |
| InChIKey | BBNFWZSLNGGFSX-UHFFFAOYSA-O |
| XLogP | 6.93 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.72 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|