3-(2-oxo-1,3-dihydroindol-3-yl)propanoic acid

C11H11NO3 — CID 589482

IUPAC3-(2-oxo-1,3-dihydroindol-3-yl)propanoic acid
SMILESO=C(O)CCC1C(=O)Nc2ccccc21
InChIInChI=1S/C11H11NO3/c13-10(14)6-5-8-7-3-1-2-4-9(7)12-11(8)15/h1-4,8H,5-6H2,(H,12,15)(H,13,14)
InChIKeyBFQGSVVUAHHSFU-UHFFFAOYSA-N
MW205.21 g/mol
LogP1.59
Rot. Bonds3

About 3-(2-oxo-1,3-dihydroindol-3-yl)propanoic acid

3-(2-oxo-1,3-dihydroindol-3-yl)propanoic acid (PubChem CID 589482) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 3-(2-oxo-1,3-dihydroindol-3-yl)propanoic acid.

Molecular Properties

Compound Name3-(2-oxo-1,3-dihydroindol-3-yl)propanoic acid
PubChem CID589482
Molecular FormulaC11H11NO3
Molecular Weight205.21 g/mol
Exact Mass205.07
IUPAC Name3-(2-oxo-1,3-dihydroindol-3-yl)propanoic acid
SMILESO=C(O)CCC1C(=O)Nc2ccccc21
InChIInChI=1S/C11H11NO3/c13-10(14)6-5-8-7-3-1-2-4-9(7)12-11(8)15/h1-4,8H,5-6H2,(H,12,15)(H,13,14)
InChIKeyBFQGSVVUAHHSFU-UHFFFAOYSA-N
XLogP1.59
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.21
LogP ≤ 51.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-(2-oxo-1,3-dihydroindol-3-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-oxo-1,3-dihydroindol-3-yl)propanoic acid?
The IUPAC name of 3-(2-oxo-1,3-dihydroindol-3-yl)propanoic acid (CID 589482) is 3-(2-oxo-1,3-dihydroindol-3-yl)propanoic acid.
What is the SMILES notation for 3-(2-oxo-1,3-dihydroindol-3-yl)propanoic acid?
The canonical SMILES for 3-(2-oxo-1,3-dihydroindol-3-yl)propanoic acid is O=C(O)CCC1C(=O)Nc2ccccc21.
What is the InChIKey of 3-(2-oxo-1,3-dihydroindol-3-yl)propanoic acid?
The InChIKey is BFQGSVVUAHHSFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3/c13-10(14)6-5-8-7-3-1-2-4-9(7)12-11(8)15/h1-4,8H,5-6H2,(H,12,15)(H,13,14).
What are the key properties of 3-(2-oxo-1,3-dihydroindol-3-yl)propanoic acid?
3-(2-oxo-1,3-dihydroindol-3-yl)propanoic acid has a molecular weight of 205.21 g/mol, XLogP of 1.59, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-oxo-1,3-dihydroindol-3-yl)propanoic acid is sourced from PubChem (CID 589482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).