About 8-methyl-4-[1-(2,2,2-trifluoro-1-phenylethyl)piperidin-4-yl]oxyquinoline
8-methyl-4-[1-(2,2,2-trifluoro-1-phenylethyl)piperidin-4-yl]oxyquinoline (PubChem CID 58948337) has the molecular formula C23H23F3N2O
and a molecular weight of 400.44 g/mol. Its IUPAC name is 8-methyl-4-[1-(2,2,2-trifluoro-1-phenylethyl)piperidin-4-yl]oxyquinoline.
Molecular Properties
| Compound Name | 8-methyl-4-[1-(2,2,2-trifluoro-1-phenylethyl)piperidin-4-yl]oxyquinoline |
| PubChem CID | 58948337 |
| Molecular Formula | C23H23F3N2O |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 8-methyl-4-[1-(2,2,2-trifluoro-1-phenylethyl)piperidin-4-yl]oxyquinoline |
| SMILES | Cc1cccc2c(OC3CCN(C(c4ccccc4)C(F)(F)F)CC3)ccnc12 |
| InChI | InChI=1S/C23H23F3N2O/c1-16-6-5-9-19-20(10-13-27-21(16)19)29-18-11-14-28(15-12-18)22(23(24,25)26)17-7-3-2-4-8-17/h2-10,13,18,22H,11-12,14-15H2,1H3 |
| InChIKey | VLVPKWNIXPIHBZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methyl-4-[1-(2,2,2-trifluoro-1-phenylethyl)piperidin-4-yl]oxyquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-4-[1-(2,2,2-trifluoro-1-phenylethyl)piperidin-4-yl]oxyquinoline?
The IUPAC name of 8-methyl-4-[1-(2,2,2-trifluoro-1-phenylethyl)piperidin-4-yl]oxyquinoline (CID 58948337) is 8-methyl-4-[1-(2,2,2-trifluoro-1-phenylethyl)piperidin-4-yl]oxyquinoline.
What is the SMILES notation for 8-methyl-4-[1-(2,2,2-trifluoro-1-phenylethyl)piperidin-4-yl]oxyquinoline?
The canonical SMILES for 8-methyl-4-[1-(2,2,2-trifluoro-1-phenylethyl)piperidin-4-yl]oxyquinoline is Cc1cccc2c(OC3CCN(C(c4ccccc4)C(F)(F)F)CC3)ccnc12.
What is the InChIKey of 8-methyl-4-[1-(2,2,2-trifluoro-1-phenylethyl)piperidin-4-yl]oxyquinoline?
The InChIKey is VLVPKWNIXPIHBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23F3N2O/c1-16-6-5-9-19-20(10-13-27-21(16)19)29-18-11-14-28(15-12-18)22(23(24,25)26)17-7-3-2-4-8-17/h2-10,13,18,22H,11-12,14-15H2,1H3.
What are the key properties of 8-methyl-4-[1-(2,2,2-trifluoro-1-phenylethyl)piperidin-4-yl]oxyquinoline?
8-methyl-4-[1-(2,2,2-trifluoro-1-phenylethyl)piperidin-4-yl]oxyquinoline has a molecular weight of 400.44 g/mol, XLogP of 5.69, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-4-[1-(2,2,2-trifluoro-1-phenylethyl)piperidin-4-yl]oxyquinoline is sourced from PubChem (CID 58948337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).