C26H25FO5S — CID 58948718
[(2S,4R,6R)-17-fluoro-13-methoxy-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 58948718) has the molecular formula C26H25FO5S and a molecular weight of 468.55 g/mol. Its IUPAC name is [(2S,4R,6R)-17-fluoro-13-methoxy-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,4R,6R)-17-fluoro-13-methoxy-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58948718 |
| Molecular Formula | C26H25FO5S |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | [(2S,4R,6R)-17-fluoro-13-methoxy-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | COC1c2ccccc2[C@H]2C[C@H](COS(=O)(=O)c3ccc(C)cc3)O[C@@H]2c2cc(F)ccc21 |
| InChI | InChI=1S/C26H25FO5S/c1-16-7-10-19(11-8-16)33(28,29)31-15-18-14-24-20-5-3-4-6-21(20)25(30-2)22-12-9-17(27)13-23(22)26(24)32-18/h3-13,18,24-26H,14-15H2,1-2H3/t18-,24-,25?,26-/m1/s1 |
| InChIKey | HTCOEWBCINZSGN-LQCXPVAGSA-N |
| XLogP | 5.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|