C21H24FNO2 — CID 58948749
(2S,4R,6R,13S)-4-[(dimethylamino)methyl]-17-fluoro-13-methyl-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-13-ol (PubChem CID 58948749) has the molecular formula C21H24FNO2 and a molecular weight of 341.43 g/mol. Its IUPAC name is (2S,4R,6R,13S)-4-[(dimethylamino)methyl]-17-fluoro-13-methyl-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-13-ol.
| Compound Name | (2S,4R,6R,13S)-4-[(dimethylamino)methyl]-17-fluoro-13-methyl-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-13-ol |
|---|---|
| PubChem CID | 58948749 |
| Molecular Formula | C21H24FNO2 |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | (2S,4R,6R,13S)-4-[(dimethylamino)methyl]-17-fluoro-13-methyl-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-13-ol |
| SMILES | CN(C)C[C@H]1C[C@@H]2c3ccccc3[C@](C)(O)c3ccc(F)cc3[C@H]2O1 |
| InChI | InChI=1S/C21H24FNO2/c1-21(24)18-7-5-4-6-15(18)16-11-14(12-23(2)3)25-20(16)17-10-13(22)8-9-19(17)21/h4-10,14,16,20,24H,11-12H2,1-3H3/t14-,16-,20+,21+/m1/s1 |
| InChIKey | RZRWDUCNDOPSIF-GNBIQWSPSA-N |
| XLogP | 3.57 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |