C17H34N10O — CID 58948876
(3S,5R)-1-[4-[(3S,5R)-3,5-diaminopiperidin-1-yl]-6-(1-methoxypropan-2-ylamino)-1,3,5-triazin-2-yl]piperidine-3,5-diamine (PubChem CID 58948876) has the molecular formula C17H34N10O and a molecular weight of 394.53 g/mol. Its IUPAC name is (3S,5R)-1-[4-[(3S,5R)-3,5-diaminopiperidin-1-yl]-6-(1-methoxypropan-2-ylamino)-1,3,5-triazin-2-yl]piperidine-3,5-diamine.
| Compound Name | (3S,5R)-1-[4-[(3S,5R)-3,5-diaminopiperidin-1-yl]-6-(1-methoxypropan-2-ylamino)-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
|---|---|
| PubChem CID | 58948876 |
| Molecular Formula | C17H34N10O |
| Molecular Weight | 394.53 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | (3S,5R)-1-[4-[(3S,5R)-3,5-diaminopiperidin-1-yl]-6-(1-methoxypropan-2-ylamino)-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
| SMILES | COCC(C)Nc1nc(N2C[C@H](N)C[C@H](N)C2)nc(N2C[C@H](N)C[C@H](N)C2)n1 |
| InChI | InChI=1S/C17H34N10O/c1-10(9-28-2)22-15-23-16(26-5-11(18)3-12(19)6-26)25-17(24-15)27-7-13(20)4-14(21)8-27/h10-14H,3-9,18-21H2,1-2H3,(H,22,23,24,25)/t10?,11-,12+,13-,14+ |
| InChIKey | QEBZFSQRWLMWTR-LTQVTBIESA-N |
| XLogP | -1.95 |
| TPSA | 170.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.53 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |