C31H38N12O2 — CID 58948903
4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxy-N-(4-pyridin-2-ylphenyl)benzamide (PubChem CID 58948903) has the molecular formula C31H38N12O2 and a molecular weight of 610.73 g/mol. Its IUPAC name is 4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxy-N-(4-pyridin-2-ylphenyl)benzamide.
| Compound Name | 4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxy-N-(4-pyridin-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 58948903 |
| Molecular Formula | C31H38N12O2 |
| Molecular Weight | 610.73 g/mol |
| Exact Mass | 610.32 |
| IUPAC Name | 4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxy-N-(4-pyridin-2-ylphenyl)benzamide |
| SMILES | N[C@@H]1C[C@H](N)CN(c2nc(Nc3ccc(C(=O)Nc4ccc(-c5ccccn5)cc4)c(O)c3)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C31H38N12O2/c32-19-11-20(33)15-42(14-19)30-39-29(40-31(41-30)43-16-21(34)12-22(35)17-43)38-24-8-9-25(27(44)13-24)28(45)37-23-6-4-18(5-7-23)26-3-1-2-10-36-26/h1-10,13,19-22,44H,11-12,14-17,32-35H2,(H,37,45)(H,38,39,40,41)/t19-,20+,21-,22+ |
| InChIKey | IRXUASNMWKBREP-COPRSSIGSA-N |
| XLogP | 1.36 |
| TPSA | 223.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.73 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |