C21H34N10 — CID 58949013
(3R,5S)-1-[4-[(3S,5R)-3,5-diaminopiperidin-1-yl]-6-[(4-methylphenyl)methylamino]-1,3,5-triazin-2-yl]piperidine-3,5-diamine (PubChem CID 58949013) has the molecular formula C21H34N10 and a molecular weight of 426.57 g/mol. Its IUPAC name is (3R,5S)-1-[4-[(3S,5R)-3,5-diaminopiperidin-1-yl]-6-[(4-methylphenyl)methylamino]-1,3,5-triazin-2-yl]piperidine-3,5-diamine.
| Compound Name | (3R,5S)-1-[4-[(3S,5R)-3,5-diaminopiperidin-1-yl]-6-[(4-methylphenyl)methylamino]-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
|---|---|
| PubChem CID | 58949013 |
| Molecular Formula | C21H34N10 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | (3R,5S)-1-[4-[(3S,5R)-3,5-diaminopiperidin-1-yl]-6-[(4-methylphenyl)methylamino]-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
| SMILES | Cc1ccc(CNc2nc(N3C[C@H](N)C[C@H](N)C3)nc(N3C[C@H](N)C[C@H](N)C3)n2)cc1 |
| InChI | InChI=1S/C21H34N10/c1-13-2-4-14(5-3-13)8-26-19-27-20(30-9-15(22)6-16(23)10-30)29-21(28-19)31-11-17(24)7-18(25)12-31/h2-5,15-18H,6-12,22-25H2,1H3,(H,26,27,28,29)/t15-,16+,17-,18+ |
| InChIKey | HLERCAQAUQIXQW-USTZCAOPSA-N |
| XLogP | -0.48 |
| TPSA | 161.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |