C19H31N11 — CID 58949081
(3R,5S)-1-[4-[(3S,5R)-3,5-diaminopiperidin-1-yl]-6-(2-phenylhydrazinyl)-1,3,5-triazin-2-yl]piperidine-3,5-diamine (PubChem CID 58949081) has the molecular formula C19H31N11 and a molecular weight of 413.53 g/mol. Its IUPAC name is (3R,5S)-1-[4-[(3S,5R)-3,5-diaminopiperidin-1-yl]-6-(2-phenylhydrazinyl)-1,3,5-triazin-2-yl]piperidine-3,5-diamine.
| Compound Name | (3R,5S)-1-[4-[(3S,5R)-3,5-diaminopiperidin-1-yl]-6-(2-phenylhydrazinyl)-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
|---|---|
| PubChem CID | 58949081 |
| Molecular Formula | C19H31N11 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | (3R,5S)-1-[4-[(3S,5R)-3,5-diaminopiperidin-1-yl]-6-(2-phenylhydrazinyl)-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
| SMILES | N[C@@H]1C[C@H](N)CN(c2nc(NNc3ccccc3)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C19H31N11/c20-12-6-13(21)9-29(8-12)18-24-17(28-27-16-4-2-1-3-5-16)25-19(26-18)30-10-14(22)7-15(23)11-30/h1-5,12-15,27H,6-11,20-23H2,(H,24,25,26,28)/t12-,13+,14-,15+ |
| InChIKey | OFUPSBPWEDETEC-NMWPEEMBSA-N |
| XLogP | -0.96 |
| TPSA | 173.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|