C22H36N10O2 — CID 58949095
4-[2-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]ethyl]-2-methoxyphenol (PubChem CID 58949095) has the molecular formula C22H36N10O2 and a molecular weight of 472.60 g/mol. Its IUPAC name is 4-[2-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]ethyl]-2-methoxyphenol.
| Compound Name | 4-[2-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]ethyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 58949095 |
| Molecular Formula | C22H36N10O2 |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | 4-[2-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]ethyl]-2-methoxyphenol |
| SMILES | COc1cc(CCNc2nc(N3C[C@H](N)C[C@H](N)C3)nc(N3C[C@H](N)C[C@H](N)C3)n2)ccc1O |
| InChI | InChI=1S/C22H36N10O2/c1-34-19-6-13(2-3-18(19)33)4-5-27-20-28-21(31-9-14(23)7-15(24)10-31)30-22(29-20)32-11-16(25)8-17(26)12-32/h2-3,6,14-17,33H,4-5,7-12,23-26H2,1H3,(H,27,28,29,30)/t14-,15+,16-,17+ |
| InChIKey | QZLRYAGCKFPUAZ-WNKDZCFJSA-N |
| XLogP | -1.03 |
| TPSA | 190.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |