C29H54O4Si2 — CID 589491
[7-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]-1,4a-dimethyl-3-triethylsilyloxy-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl] acetate (PubChem CID 589491) has the molecular formula C29H54O4Si2 and a molecular weight of 522.92 g/mol. Its IUPAC name is [7-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]-1,4a-dimethyl-3-triethylsilyloxy-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl] acetate.
| Compound Name | [7-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]-1,4a-dimethyl-3-triethylsilyloxy-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 589491 |
| Molecular Formula | C29H54O4Si2 |
| Molecular Weight | 522.92 g/mol |
| Exact Mass | 522.36 |
| IUPAC Name | [7-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]-1,4a-dimethyl-3-triethylsilyloxy-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl] acetate |
| SMILES | C=C(CO[Si](C)(C)C(C)(C)C)C1CCC2(C)CC(O[Si](CC)(CC)CC)C(OC(C)=O)C(C)=C2C1 |
| InChI | InChI=1S/C29H54O4Si2/c1-13-35(14-2,15-3)33-26-19-29(10)17-16-24(18-25(29)22(5)27(26)32-23(6)30)21(4)20-31-34(11,12)28(7,8)9/h24,26-27H,4,13-20H2,1-3,5-12H3 |
| InChIKey | AJQFATGLRDWQOA-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.92 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|