C25H36N10O2 — CID 58949336
7-[[4-[(3S,5R)-3,5-bis(aminomethyl)piperidin-1-yl]-6-[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-4-methylchromen-2-one (PubChem CID 58949336) has the molecular formula C25H36N10O2 and a molecular weight of 508.63 g/mol. Its IUPAC name is 7-[[4-[(3S,5R)-3,5-bis(aminomethyl)piperidin-1-yl]-6-[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-4-methylchromen-2-one.
| Compound Name | 7-[[4-[(3S,5R)-3,5-bis(aminomethyl)piperidin-1-yl]-6-[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 58949336 |
| Molecular Formula | C25H36N10O2 |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | 7-[[4-[(3S,5R)-3,5-bis(aminomethyl)piperidin-1-yl]-6-[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(Nc3nc(N4C[C@H](N)C[C@H](N)C4)nc(N4C[C@H](CN)C[C@H](CN)C4)n3)ccc12 |
| InChI | InChI=1S/C25H36N10O2/c1-14-4-22(36)37-21-7-19(2-3-20(14)21)30-23-31-24(34-10-15(8-26)5-16(9-27)11-34)33-25(32-23)35-12-17(28)6-18(29)13-35/h2-4,7,15-18H,5-6,8-13,26-29H2,1H3,(H,30,31,32,33)/t15-,16+,17-,18+ |
| InChIKey | OZXNUSNGDVFOES-USTZCAOPSA-N |
| XLogP | 0.25 |
| TPSA | 191.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|