C24H36N12O3S — CID 58949387
4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-N-(4,5-dimethyl-1,3-oxazol-2-yl)benzenesulfonamide (PubChem CID 58949387) has the molecular formula C24H36N12O3S and a molecular weight of 572.70 g/mol. Its IUPAC name is 4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-N-(4,5-dimethyl-1,3-oxazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-N-(4,5-dimethyl-1,3-oxazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 58949387 |
| Molecular Formula | C24H36N12O3S |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | 4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-N-(4,5-dimethyl-1,3-oxazol-2-yl)benzenesulfonamide |
| SMILES | Cc1nc(NS(=O)(=O)c2ccc(Nc3nc(N4C[C@H](N)C[C@H](N)C4)nc(N4C[C@H](N)C[C@H](N)C4)n3)cc2)oc1C |
| InChI | InChI=1S/C24H36N12O3S/c1-13-14(2)39-24(29-13)34-40(37,38)20-5-3-19(4-6-20)30-21-31-22(35-9-15(25)7-16(26)10-35)33-23(32-21)36-11-17(27)8-18(28)12-36/h3-6,15-18H,7-12,25-28H2,1-2H3,(H,29,34)(H,30,31,32,33)/t15-,16+,17-,18+ |
| InChIKey | KOKHKPWPIOHDCU-USTZCAOPSA-N |
| XLogP | -0.25 |
| TPSA | 233.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |