C26H34BrN11O2 — CID 58949417
N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-5-bromo-2-hydroxybenzamide (PubChem CID 58949417) has the molecular formula C26H34BrN11O2 and a molecular weight of 612.54 g/mol. Its IUPAC name is N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-5-bromo-2-hydroxybenzamide.
| Compound Name | N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-5-bromo-2-hydroxybenzamide |
|---|---|
| PubChem CID | 58949417 |
| Molecular Formula | C26H34BrN11O2 |
| Molecular Weight | 612.54 g/mol |
| Exact Mass | 611.21 |
| IUPAC Name | N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-5-bromo-2-hydroxybenzamide |
| SMILES | N[C@@H]1C[C@H](N)CN(c2nc(Nc3ccc(NC(=O)c4cc(Br)ccc4O)cc3)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C26H34BrN11O2/c27-14-1-6-22(39)21(7-14)23(40)32-19-2-4-20(5-3-19)33-24-34-25(37-10-15(28)8-16(29)11-37)36-26(35-24)38-12-17(30)9-18(31)13-38/h1-7,15-18,39H,8-13,28-31H2,(H,32,40)(H,33,34,35,36)/t15-,16+,17-,18+ |
| InChIKey | JIEAZYGXSYMQPY-USTZCAOPSA-N |
| XLogP | 1.07 |
| TPSA | 210.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.54 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |