About N-(2-benzyl-1-oxo-3,4-dihydroisoquinolin-5-yl)-3-fluoroadamantane-1-carboxamide
N-(2-benzyl-1-oxo-3,4-dihydroisoquinolin-5-yl)-3-fluoroadamantane-1-carboxamide (PubChem CID 58949687) has the molecular formula C27H29FN2O2
and a molecular weight of 432.54 g/mol. Its IUPAC name is N-(2-benzyl-1-oxo-3,4-dihydroisoquinolin-5-yl)-3-fluoroadamantane-1-carboxamide.
Molecular Properties
| Compound Name | N-(2-benzyl-1-oxo-3,4-dihydroisoquinolin-5-yl)-3-fluoroadamantane-1-carboxamide |
| PubChem CID | 58949687 |
| Molecular Formula | C27H29FN2O2 |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | N-(2-benzyl-1-oxo-3,4-dihydroisoquinolin-5-yl)-3-fluoroadamantane-1-carboxamide |
| SMILES | O=C1c2cccc(NC(=O)C34CC5CC(CC(F)(C5)C3)C4)c2CCN1Cc1ccccc1 |
| InChI | InChI=1S/C27H29FN2O2/c28-27-14-19-11-20(15-27)13-26(12-19,17-27)25(32)29-23-8-4-7-22-21(23)9-10-30(24(22)31)16-18-5-2-1-3-6-18/h1-8,19-20H,9-17H2,(H,29,32) |
| InChIKey | OUHZPMFRNNRAOV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-benzyl-1-oxo-3,4-dihydroisoquinolin-5-yl)-3-fluoroadamantane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-benzyl-1-oxo-3,4-dihydroisoquinolin-5-yl)-3-fluoroadamantane-1-carboxamide?
The IUPAC name of N-(2-benzyl-1-oxo-3,4-dihydroisoquinolin-5-yl)-3-fluoroadamantane-1-carboxamide (CID 58949687) is N-(2-benzyl-1-oxo-3,4-dihydroisoquinolin-5-yl)-3-fluoroadamantane-1-carboxamide.
What is the SMILES notation for N-(2-benzyl-1-oxo-3,4-dihydroisoquinolin-5-yl)-3-fluoroadamantane-1-carboxamide?
The canonical SMILES for N-(2-benzyl-1-oxo-3,4-dihydroisoquinolin-5-yl)-3-fluoroadamantane-1-carboxamide is O=C1c2cccc(NC(=O)C34CC5CC(CC(F)(C5)C3)C4)c2CCN1Cc1ccccc1.
What is the InChIKey of N-(2-benzyl-1-oxo-3,4-dihydroisoquinolin-5-yl)-3-fluoroadamantane-1-carboxamide?
The InChIKey is OUHZPMFRNNRAOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H29FN2O2/c28-27-14-19-11-20(15-27)13-26(12-19,17-27)25(32)29-23-8-4-7-22-21(23)9-10-30(24(22)31)16-18-5-2-1-3-6-18/h1-8,19-20H,9-17H2,(H,29,32).
What are the key properties of N-(2-benzyl-1-oxo-3,4-dihydroisoquinolin-5-yl)-3-fluoroadamantane-1-carboxamide?
N-(2-benzyl-1-oxo-3,4-dihydroisoquinolin-5-yl)-3-fluoroadamantane-1-carboxamide has a molecular weight of 432.54 g/mol, XLogP of 5.13, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-benzyl-1-oxo-3,4-dihydroisoquinolin-5-yl)-3-fluoroadamantane-1-carboxamide is sourced from PubChem (CID 58949687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).