About 2-[1-(4-chlorophenyl)sulfonylhept-6-enyl]-1,3,4-trifluorobenzene
2-[1-(4-chlorophenyl)sulfonylhept-6-enyl]-1,3,4-trifluorobenzene (PubChem CID 58950054) has the molecular formula C19H18ClF3O2S
and a molecular weight of 402.87 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)sulfonylhept-6-enyl]-1,3,4-trifluorobenzene.
Molecular Properties
| Compound Name | 2-[1-(4-chlorophenyl)sulfonylhept-6-enyl]-1,3,4-trifluorobenzene |
| PubChem CID | 58950054 |
| Molecular Formula | C19H18ClF3O2S |
| Molecular Weight | 402.87 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 2-[1-(4-chlorophenyl)sulfonylhept-6-enyl]-1,3,4-trifluorobenzene |
| SMILES | C=CCCCCC(c1c(F)ccc(F)c1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18ClF3O2S/c1-2-3-4-5-6-17(18-15(21)11-12-16(22)19(18)23)26(24,25)14-9-7-13(20)8-10-14/h2,7-12,17H,1,3-6H2 |
| InChIKey | IHBWXVIOZBKNJQ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.87 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(4-chlorophenyl)sulfonylhept-6-enyl]-1,3,4-trifluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(4-chlorophenyl)sulfonylhept-6-enyl]-1,3,4-trifluorobenzene?
The IUPAC name of 2-[1-(4-chlorophenyl)sulfonylhept-6-enyl]-1,3,4-trifluorobenzene (CID 58950054) is 2-[1-(4-chlorophenyl)sulfonylhept-6-enyl]-1,3,4-trifluorobenzene.
What is the SMILES notation for 2-[1-(4-chlorophenyl)sulfonylhept-6-enyl]-1,3,4-trifluorobenzene?
The canonical SMILES for 2-[1-(4-chlorophenyl)sulfonylhept-6-enyl]-1,3,4-trifluorobenzene is C=CCCCCC(c1c(F)ccc(F)c1F)S(=O)(=O)c1ccc(Cl)cc1.
What is the InChIKey of 2-[1-(4-chlorophenyl)sulfonylhept-6-enyl]-1,3,4-trifluorobenzene?
The InChIKey is IHBWXVIOZBKNJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClF3O2S/c1-2-3-4-5-6-17(18-15(21)11-12-16(22)19(18)23)26(24,25)14-9-7-13(20)8-10-14/h2,7-12,17H,1,3-6H2.
What are the key properties of 2-[1-(4-chlorophenyl)sulfonylhept-6-enyl]-1,3,4-trifluorobenzene?
2-[1-(4-chlorophenyl)sulfonylhept-6-enyl]-1,3,4-trifluorobenzene has a molecular weight of 402.87 g/mol, XLogP of 6.02, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4-chlorophenyl)sulfonylhept-6-enyl]-1,3,4-trifluorobenzene is sourced from PubChem (CID 58950054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).