C20H20ClF2NO3S — CID 58950075
(4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-4-ethyl-7,10-difluoro-2,3,4a,5-tetrahydro-1H-chromeno[3,4-b]pyridine (PubChem CID 58950075) has the molecular formula C20H20ClF2NO3S and a molecular weight of 427.90 g/mol. Its IUPAC name is (4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-4-ethyl-7,10-difluoro-2,3,4a,5-tetrahydro-1H-chromeno[3,4-b]pyridine.
| Compound Name | (4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-4-ethyl-7,10-difluoro-2,3,4a,5-tetrahydro-1H-chromeno[3,4-b]pyridine |
|---|---|
| PubChem CID | 58950075 |
| Molecular Formula | C20H20ClF2NO3S |
| Molecular Weight | 427.90 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | (4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-4-ethyl-7,10-difluoro-2,3,4a,5-tetrahydro-1H-chromeno[3,4-b]pyridine |
| SMILES | CCN1CCC[C@]2(S(=O)(=O)c3ccc(Cl)cc3)c3c(F)ccc(F)c3OC[C@H]12 |
| InChI | InChI=1S/C20H20ClF2NO3S/c1-2-24-11-3-10-20(28(25,26)14-6-4-13(21)5-7-14)17(24)12-27-19-16(23)9-8-15(22)18(19)20/h4-9,17H,2-3,10-12H2,1H3/t17-,20+/m0/s1 |
| InChIKey | NUEPMFFIFIPUFX-FXAWDEMLSA-N |
| XLogP | 4.16 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.90 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |