C24H23F5O5S — CID 58950083
ethyl 2-[(6aR,8R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl]acetate (PubChem CID 58950083) has the molecular formula C24H23F5O5S and a molecular weight of 518.50 g/mol. Its IUPAC name is ethyl 2-[(6aR,8R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl]acetate.
| Compound Name | ethyl 2-[(6aR,8R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl]acetate |
|---|---|
| PubChem CID | 58950083 |
| Molecular Formula | C24H23F5O5S |
| Molecular Weight | 518.50 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | ethyl 2-[(6aR,8R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CC[C@@]2(S(=O)(=O)c3ccc(C(F)(F)F)cc3)c3c(F)ccc(F)c3OC[C@H]2C1 |
| InChI | InChI=1S/C24H23F5O5S/c1-2-33-20(30)12-14-9-10-23(35(31,32)17-5-3-15(4-6-17)24(27,28)29)16(11-14)13-34-22-19(26)8-7-18(25)21(22)23/h3-8,14,16H,2,9-13H2,1H3/t14-,16-,23+/m1/s1 |
| InChIKey | NMZPPHWEJNZNHV-SWHMAYCHSA-N |
| XLogP | 5.41 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.50 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |