C28H23F5O6S2 — CID 58950096
(6aR,7S)-7-[2-(benzenesulfonyl)ethyl]-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6a,7,9,10-tetrahydro-6H-benzo[c]chromen-8-one (PubChem CID 58950096) has the molecular formula C28H23F5O6S2 and a molecular weight of 614.61 g/mol. Its IUPAC name is (6aR,7S)-7-[2-(benzenesulfonyl)ethyl]-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6a,7,9,10-tetrahydro-6H-benzo[c]chromen-8-one.
| Compound Name | (6aR,7S)-7-[2-(benzenesulfonyl)ethyl]-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6a,7,9,10-tetrahydro-6H-benzo[c]chromen-8-one |
|---|---|
| PubChem CID | 58950096 |
| Molecular Formula | C28H23F5O6S2 |
| Molecular Weight | 614.61 g/mol |
| Exact Mass | 614.09 |
| IUPAC Name | (6aR,7S)-7-[2-(benzenesulfonyl)ethyl]-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6a,7,9,10-tetrahydro-6H-benzo[c]chromen-8-one |
| SMILES | O=C1CCC2(S(=O)(=O)c3ccc(C(F)(F)F)cc3)c3c(F)ccc(F)c3OC[C@H]2[C@@H]1CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H23F5O6S2/c29-22-10-11-23(30)26-25(22)27(41(37,38)19-8-6-17(7-9-19)28(31,32)33)14-12-24(34)20(21(27)16-39-26)13-15-40(35,36)18-4-2-1-3-5-18/h1-11,20-21H,12-16H2/t20-,21-,27?/m0/s1 |
| InChIKey | DZWIOHVRBWNOHH-XSVUGYHLSA-N |
| XLogP | 5.50 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.61 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |