C20H15ClF5NO4S — CID 58950100
1-[(4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,3,4a,5-tetrahydro-1H-chromeno[3,4-b]pyridin-4-yl]-2,2,2-trifluoroethanone (PubChem CID 58950100) has the molecular formula C20H15ClF5NO4S and a molecular weight of 495.85 g/mol. Its IUPAC name is 1-[(4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,3,4a,5-tetrahydro-1H-chromeno[3,4-b]pyridin-4-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,3,4a,5-tetrahydro-1H-chromeno[3,4-b]pyridin-4-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 58950100 |
| Molecular Formula | C20H15ClF5NO4S |
| Molecular Weight | 495.85 g/mol |
| Exact Mass | 495.03 |
| IUPAC Name | 1-[(4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,3,4a,5-tetrahydro-1H-chromeno[3,4-b]pyridin-4-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(N1CCC[C@]2(S(=O)(=O)c3ccc(Cl)cc3)c3c(F)ccc(F)c3OC[C@H]12)C(F)(F)F |
| InChI | InChI=1S/C20H15ClF5NO4S/c21-11-2-4-12(5-3-11)32(29,30)19-8-1-9-27(18(28)20(24,25)26)15(19)10-31-17-14(23)7-6-13(22)16(17)19/h2-7,15H,1,8-10H2/t15-,19+/m0/s1 |
| InChIKey | UEFDBPNEDVMNTC-HNAYVOBHSA-N |
| XLogP | 4.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.85 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |