C21H19ClF2O4S — CID 58950144
(4R,4aR,10bR)-10b-(4-chlorophenyl)sulfonyl-4-cyclopropyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromene (PubChem CID 58950144) has the molecular formula C21H19ClF2O4S and a molecular weight of 440.90 g/mol. Its IUPAC name is (4R,4aR,10bR)-10b-(4-chlorophenyl)sulfonyl-4-cyclopropyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromene.
| Compound Name | (4R,4aR,10bR)-10b-(4-chlorophenyl)sulfonyl-4-cyclopropyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromene |
|---|---|
| PubChem CID | 58950144 |
| Molecular Formula | C21H19ClF2O4S |
| Molecular Weight | 440.90 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | (4R,4aR,10bR)-10b-(4-chlorophenyl)sulfonyl-4-cyclopropyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromene |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)[C@]12CCO[C@H](C3CC3)[C@H]1COc1c(F)ccc(F)c12 |
| InChI | InChI=1S/C21H19ClF2O4S/c22-13-3-5-14(6-4-13)29(25,26)21-9-10-27-19(12-1-2-12)15(21)11-28-20-17(24)8-7-16(23)18(20)21/h3-8,12,15,19H,1-2,9-11H2/t15-,19-,21-/m1/s1 |
| InChIKey | DSCKZDSMZGVXML-QFIXIFRTSA-N |
| XLogP | 4.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.90 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |