C23H25ClF2N2O4S — CID 58950178
1-[[(6aR,7R,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methyl]-3-ethylurea (PubChem CID 58950178) has the molecular formula C23H25ClF2N2O4S and a molecular weight of 498.98 g/mol. Its IUPAC name is 1-[[(6aR,7R,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methyl]-3-ethylurea.
| Compound Name | 1-[[(6aR,7R,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methyl]-3-ethylurea |
|---|---|
| PubChem CID | 58950178 |
| Molecular Formula | C23H25ClF2N2O4S |
| Molecular Weight | 498.98 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 1-[[(6aR,7R,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methyl]-3-ethylurea |
| SMILES | CCNC(=O)NC[C@@H]1CCC[C@@]2(S(=O)(=O)c3ccc(Cl)cc3)c3c(F)ccc(F)c3OC[C@@H]12 |
| InChI | InChI=1S/C23H25ClF2N2O4S/c1-2-27-22(29)28-12-14-4-3-11-23(33(30,31)16-7-5-15(24)6-8-16)17(14)13-32-21-19(26)10-9-18(25)20(21)23/h5-10,14,17H,2-4,11-13H2,1H3,(H2,27,28,29)/t14-,17-,23-/m0/s1 |
| InChIKey | JEZTUMZZVWLUHH-GJYADEQXSA-N |
| XLogP | 4.42 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.98 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |