C26H23ClF2O5S2 — CID 58950306
(8R,10aS)-8-(benzenesulfonylmethyl)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromene (PubChem CID 58950306) has the molecular formula C26H23ClF2O5S2 and a molecular weight of 553.05 g/mol. Its IUPAC name is (8R,10aS)-8-(benzenesulfonylmethyl)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromene.
| Compound Name | (8R,10aS)-8-(benzenesulfonylmethyl)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromene |
|---|---|
| PubChem CID | 58950306 |
| Molecular Formula | C26H23ClF2O5S2 |
| Molecular Weight | 553.05 g/mol |
| Exact Mass | 552.06 |
| IUPAC Name | (8R,10aS)-8-(benzenesulfonylmethyl)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromene |
| SMILES | O=S(=O)(C[C@@H]1CC[C@@]2(S(=O)(=O)c3ccc(Cl)cc3)c3c(F)ccc(F)c3OCC2C1)c1ccccc1 |
| InChI | InChI=1S/C26H23ClF2O5S2/c27-19-6-8-21(9-7-19)36(32,33)26-13-12-17(16-35(30,31)20-4-2-1-3-5-20)14-18(26)15-34-25-23(29)11-10-22(28)24(25)26/h1-11,17-18H,12-16H2/t17-,18?,26+/m1/s1 |
| InChIKey | KWLGHJASJBZBPF-BHXRTPDVSA-N |
| XLogP | 5.57 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.05 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |