C20H17F2NO4S — CID 58950326
(6aR,8R,10aS)-1,4-difluoro-10a-(4-isocyanophenyl)sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-ol (PubChem CID 58950326) has the molecular formula C20H17F2NO4S and a molecular weight of 405.42 g/mol. Its IUPAC name is (6aR,8R,10aS)-1,4-difluoro-10a-(4-isocyanophenyl)sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-ol.
| Compound Name | (6aR,8R,10aS)-1,4-difluoro-10a-(4-isocyanophenyl)sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-ol |
|---|---|
| PubChem CID | 58950326 |
| Molecular Formula | C20H17F2NO4S |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | (6aR,8R,10aS)-1,4-difluoro-10a-(4-isocyanophenyl)sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-ol |
| SMILES | [C-]#[N+]c1ccc(S(=O)(=O)[C@@]23CC[C@@H](O)C[C@@H]2COc2c(F)ccc(F)c23)cc1 |
| InChI | InChI=1S/C20H17F2NO4S/c1-23-13-2-4-15(5-3-13)28(25,26)20-9-8-14(24)10-12(20)11-27-19-17(22)7-6-16(21)18(19)20/h2-7,12,14,24H,8-11H2/t12-,14-,20+/m1/s1 |
| InChIKey | JTFHPSSFKXOVFG-ZGLRSVDFSA-N |
| XLogP | 3.74 |
| TPSA | 67.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|