C24H26F5NO7S3 — CID 58950335
N-[2-[(6aR,8R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl]ethyl]-N-methylsulfonylmethanesulfonamide (PubChem CID 58950335) has the molecular formula C24H26F5NO7S3 and a molecular weight of 631.66 g/mol. Its IUPAC name is N-[2-[(6aR,8R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl]ethyl]-N-methylsulfonylmethanesulfonamide.
| Compound Name | N-[2-[(6aR,8R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl]ethyl]-N-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 58950335 |
| Molecular Formula | C24H26F5NO7S3 |
| Molecular Weight | 631.66 g/mol |
| Exact Mass | 631.08 |
| IUPAC Name | N-[2-[(6aR,8R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl]ethyl]-N-methylsulfonylmethanesulfonamide |
| SMILES | CS(=O)(=O)N(CC[C@@H]1CC[C@@]2(S(=O)(=O)c3ccc(C(F)(F)F)cc3)c3c(F)ccc(F)c3OC[C@H]2C1)S(C)(=O)=O |
| InChI | InChI=1S/C24H26F5NO7S3/c1-38(31,32)30(39(2,33)34)12-10-15-9-11-23(40(35,36)18-5-3-16(4-6-18)24(27,28)29)17(13-15)14-37-22-20(26)8-7-19(25)21(22)23/h3-8,15,17H,9-14H2,1-2H3/t15-,17+,23-/m0/s1 |
| InChIKey | BZVBCQSJOHYQOD-JCEJCQQGSA-N |
| XLogP | 4.07 |
| TPSA | 114.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.66 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |