C23H17Cl2F2NO4S2 — CID 58950351
[(4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,3,4a,5-tetrahydro-1H-chromeno[3,4-b]pyridin-4-yl]-(3-chlorothiophen-2-yl)methanone (PubChem CID 58950351) has the molecular formula C23H17Cl2F2NO4S2 and a molecular weight of 544.43 g/mol. Its IUPAC name is [(4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,3,4a,5-tetrahydro-1H-chromeno[3,4-b]pyridin-4-yl]-(3-chlorothiophen-2-yl)methanone.
| Compound Name | [(4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,3,4a,5-tetrahydro-1H-chromeno[3,4-b]pyridin-4-yl]-(3-chlorothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 58950351 |
| Molecular Formula | C23H17Cl2F2NO4S2 |
| Molecular Weight | 544.43 g/mol |
| Exact Mass | 542.99 |
| IUPAC Name | [(4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,3,4a,5-tetrahydro-1H-chromeno[3,4-b]pyridin-4-yl]-(3-chlorothiophen-2-yl)methanone |
| SMILES | O=C(c1sccc1Cl)N1CCC[C@]2(S(=O)(=O)c3ccc(Cl)cc3)c3c(F)ccc(F)c3OC[C@H]12 |
| InChI | InChI=1S/C23H17Cl2F2NO4S2/c24-13-2-4-14(5-3-13)34(30,31)23-9-1-10-28(22(29)21-15(25)8-11-33-21)18(23)12-32-20-17(27)7-6-16(26)19(20)23/h2-8,11,18H,1,9-10,12H2/t18-,23+/m0/s1 |
| InChIKey | GCOHWYXKQOUYCV-FDDCHVKYSA-N |
| XLogP | 5.70 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.43 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |