C22H22ClF2NO5S — CID 58950437
[(6aR,8R,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl]methyl N-methylcarbamate (PubChem CID 58950437) has the molecular formula C22H22ClF2NO5S and a molecular weight of 485.94 g/mol. Its IUPAC name is [(6aR,8R,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl]methyl N-methylcarbamate.
| Compound Name | [(6aR,8R,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 58950437 |
| Molecular Formula | C22H22ClF2NO5S |
| Molecular Weight | 485.94 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | [(6aR,8R,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OC[C@@H]1CC[C@@]2(S(=O)(=O)c3ccc(Cl)cc3)c3c(F)ccc(F)c3OC[C@H]2C1 |
| InChI | InChI=1S/C22H22ClF2NO5S/c1-26-21(27)31-11-13-8-9-22(32(28,29)16-4-2-15(23)3-5-16)14(10-13)12-30-20-18(25)7-6-17(24)19(20)22/h2-7,13-14H,8-12H2,1H3,(H,26,27)/t13-,14-,22+/m1/s1 |
| InChIKey | WLKHCACHWGGDNA-SOHPYSCWSA-N |
| XLogP | 4.45 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.94 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |