C21H18Cl2F2O5S — CID 58950467
[(7R,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methyl carbonochloridate (PubChem CID 58950467) has the molecular formula C21H18Cl2F2O5S and a molecular weight of 491.34 g/mol. Its IUPAC name is [(7R,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methyl carbonochloridate.
| Compound Name | [(7R,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methyl carbonochloridate |
|---|---|
| PubChem CID | 58950467 |
| Molecular Formula | C21H18Cl2F2O5S |
| Molecular Weight | 491.34 g/mol |
| Exact Mass | 490.02 |
| IUPAC Name | [(7R,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methyl carbonochloridate |
| SMILES | O=C(Cl)OC[C@@H]1CCC[C@@]2(S(=O)(=O)c3ccc(Cl)cc3)c3c(F)ccc(F)c3OCC12 |
| InChI | InChI=1S/C21H18Cl2F2O5S/c22-13-3-5-14(6-4-13)31(27,28)21-9-1-2-12(10-30-20(23)26)15(21)11-29-19-17(25)8-7-16(24)18(19)21/h3-8,12,15H,1-2,9-11H2/t12-,15?,21-/m0/s1 |
| InChIKey | HSLGHAMUPIGTDT-OPBJJKDRSA-N |
| XLogP | 5.47 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.34 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|