C28H25ClF2O7S — CID 58950543
methyl 2-[4-(4-chlorophenyl)sulfonyl-5,8-difluoro-3,4-dihydro-2H-chromen-3-yl]-3-oxo-5-phenylmethoxypentanoate (PubChem CID 58950543) has the molecular formula C28H25ClF2O7S and a molecular weight of 579.02 g/mol. Its IUPAC name is methyl 2-[4-(4-chlorophenyl)sulfonyl-5,8-difluoro-3,4-dihydro-2H-chromen-3-yl]-3-oxo-5-phenylmethoxypentanoate.
| Compound Name | methyl 2-[4-(4-chlorophenyl)sulfonyl-5,8-difluoro-3,4-dihydro-2H-chromen-3-yl]-3-oxo-5-phenylmethoxypentanoate |
|---|---|
| PubChem CID | 58950543 |
| Molecular Formula | C28H25ClF2O7S |
| Molecular Weight | 579.02 g/mol |
| Exact Mass | 578.10 |
| IUPAC Name | methyl 2-[4-(4-chlorophenyl)sulfonyl-5,8-difluoro-3,4-dihydro-2H-chromen-3-yl]-3-oxo-5-phenylmethoxypentanoate |
| SMILES | COC(=O)C(C(=O)CCOCc1ccccc1)C1COc2c(F)ccc(F)c2C1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H25ClF2O7S/c1-36-28(33)24(23(32)13-14-37-15-17-5-3-2-4-6-17)20-16-38-26-22(31)12-11-21(30)25(26)27(20)39(34,35)19-9-7-18(29)8-10-19/h2-12,20,24,27H,13-16H2,1H3 |
| InChIKey | CIFOGJYRDBKVHF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.02 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|