C18H21BN2O — CID 58950655
(3aR)-1-methyl-3,3-diphenyl-5,6-dihydro-4H-pyrrolo[1,2-c][1,3,2]oxazaborol-3a-amine (PubChem CID 58950655) has the molecular formula C18H21BN2O and a molecular weight of 292.19 g/mol. Its IUPAC name is (3aR)-1-methyl-3,3-diphenyl-5,6-dihydro-4H-pyrrolo[1,2-c][1,3,2]oxazaborol-3a-amine.
| Compound Name | (3aR)-1-methyl-3,3-diphenyl-5,6-dihydro-4H-pyrrolo[1,2-c][1,3,2]oxazaborol-3a-amine |
|---|---|
| PubChem CID | 58950655 |
| Molecular Formula | C18H21BN2O |
| Molecular Weight | 292.19 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (3aR)-1-methyl-3,3-diphenyl-5,6-dihydro-4H-pyrrolo[1,2-c][1,3,2]oxazaborol-3a-amine |
| SMILES | CB1OC(c2ccccc2)(c2ccccc2)[C@@]2(N)CCCN12 |
| InChI | InChI=1S/C18H21BN2O/c1-19-21-14-8-13-17(21,20)18(22-19,15-9-4-2-5-10-15)16-11-6-3-7-12-16/h2-7,9-12H,8,13-14,20H2,1H3/t17-/m1/s1 |
| InChIKey | FNGHIQAVSPVLBY-QGZVFWFLSA-N |
| XLogP | 2.83 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.19 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|