About 5,6-difluoro-7-(methoxymethyl)-2,3-dihydro-1H-inden-1-ol
5,6-difluoro-7-(methoxymethyl)-2,3-dihydro-1H-inden-1-ol (PubChem CID 58950939) has the molecular formula C11H12F2O2
and a molecular weight of 214.21 g/mol. Its IUPAC name is 5,6-difluoro-7-(methoxymethyl)-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | 5,6-difluoro-7-(methoxymethyl)-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 58950939 |
| Molecular Formula | C11H12F2O2 |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 5,6-difluoro-7-(methoxymethyl)-2,3-dihydro-1H-inden-1-ol |
| SMILES | COCc1c(F)c(F)cc2c1C(O)CC2 |
| InChI | InChI=1S/C11H12F2O2/c1-15-5-7-10-6(2-3-9(10)14)4-8(12)11(7)13/h4,9,14H,2-3,5H2,1H3 |
| InChIKey | VROVGIGDHHFXDT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-difluoro-7-(methoxymethyl)-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-difluoro-7-(methoxymethyl)-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of 5,6-difluoro-7-(methoxymethyl)-2,3-dihydro-1H-inden-1-ol (CID 58950939) is 5,6-difluoro-7-(methoxymethyl)-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for 5,6-difluoro-7-(methoxymethyl)-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for 5,6-difluoro-7-(methoxymethyl)-2,3-dihydro-1H-inden-1-ol is COCc1c(F)c(F)cc2c1C(O)CC2.
What is the InChIKey of 5,6-difluoro-7-(methoxymethyl)-2,3-dihydro-1H-inden-1-ol?
The InChIKey is VROVGIGDHHFXDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2O2/c1-15-5-7-10-6(2-3-9(10)14)4-8(12)11(7)13/h4,9,14H,2-3,5H2,1H3.
What are the key properties of 5,6-difluoro-7-(methoxymethyl)-2,3-dihydro-1H-inden-1-ol?
5,6-difluoro-7-(methoxymethyl)-2,3-dihydro-1H-inden-1-ol has a molecular weight of 214.21 g/mol, XLogP of 2.09, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-difluoro-7-(methoxymethyl)-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 58950939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).