C17H29NO — CID 58951031
2,2-dimethyl-1-(1-methylpiperidin-4-yl)-4,5,6,7-tetrahydro-3H-inden-1-ol (PubChem CID 58951031) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is 2,2-dimethyl-1-(1-methylpiperidin-4-yl)-4,5,6,7-tetrahydro-3H-inden-1-ol.
| Compound Name | 2,2-dimethyl-1-(1-methylpiperidin-4-yl)-4,5,6,7-tetrahydro-3H-inden-1-ol |
|---|---|
| PubChem CID | 58951031 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 2,2-dimethyl-1-(1-methylpiperidin-4-yl)-4,5,6,7-tetrahydro-3H-inden-1-ol |
| SMILES | CN1CCC(C2(O)C3=C(CCCC3)CC2(C)C)CC1 |
| InChI | InChI=1S/C17H29NO/c1-16(2)12-13-6-4-5-7-15(13)17(16,19)14-8-10-18(3)11-9-14/h14,19H,4-12H2,1-3H3 |
| InChIKey | BEVIZNGYTLFTLC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|