C19H33NO — CID 58951127
2,2,6,6-tetramethyl-1-(1-methylpiperidin-4-yl)-3,4,5,7-tetrahydroinden-1-ol (PubChem CID 58951127) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-(1-methylpiperidin-4-yl)-3,4,5,7-tetrahydroinden-1-ol.
| Compound Name | 2,2,6,6-tetramethyl-1-(1-methylpiperidin-4-yl)-3,4,5,7-tetrahydroinden-1-ol |
|---|---|
| PubChem CID | 58951127 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-(1-methylpiperidin-4-yl)-3,4,5,7-tetrahydroinden-1-ol |
| SMILES | CN1CCC(C2(O)C3=C(CCC(C)(C)C3)CC2(C)C)CC1 |
| InChI | InChI=1S/C19H33NO/c1-17(2)9-6-14-12-18(3,4)19(21,16(14)13-17)15-7-10-20(5)11-8-15/h15,21H,6-13H2,1-5H3 |
| InChIKey | DQUPTUNBWJHDJC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|