C13H16O2 — CID 58951213
2-(2-hydroxyethyl)-2,6-dimethyl-3H-inden-1-one (PubChem CID 58951213) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-2,6-dimethyl-3H-inden-1-one.
| Compound Name | 2-(2-hydroxyethyl)-2,6-dimethyl-3H-inden-1-one |
|---|---|
| PubChem CID | 58951213 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 2-(2-hydroxyethyl)-2,6-dimethyl-3H-inden-1-one |
| SMILES | Cc1ccc2c(c1)C(=O)C(C)(CCO)C2 |
| InChI | InChI=1S/C13H16O2/c1-9-3-4-10-8-13(2,5-6-14)12(15)11(10)7-9/h3-4,7,14H,5-6,8H2,1-2H3 |
| InChIKey | JMSHSUYSPDXAGF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |