About tert-butyl 2-methyl-2-[[(1R,3S)-3-(oxan-2-yloxy)cyclohexyl]methoxy]-3-phenylpropanoate
tert-butyl 2-methyl-2-[[(1R,3S)-3-(oxan-2-yloxy)cyclohexyl]methoxy]-3-phenylpropanoate (PubChem CID 58951521) has the molecular formula C26H40O5
and a molecular weight of 432.60 g/mol. Its IUPAC name is tert-butyl 2-methyl-2-[[(1R,3S)-3-(oxan-2-yloxy)cyclohexyl]methoxy]-3-phenylpropanoate.
Molecular Properties
| Compound Name | tert-butyl 2-methyl-2-[[(1R,3S)-3-(oxan-2-yloxy)cyclohexyl]methoxy]-3-phenylpropanoate |
| PubChem CID | 58951521 |
| Molecular Formula | C26H40O5 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | tert-butyl 2-methyl-2-[[(1R,3S)-3-(oxan-2-yloxy)cyclohexyl]methoxy]-3-phenylpropanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(Cc1ccccc1)OC[C@@H]1CCC[C@H](OC2CCCCO2)C1 |
| InChI | InChI=1S/C26H40O5/c1-25(2,3)31-24(27)26(4,18-20-11-6-5-7-12-20)29-19-21-13-10-14-22(17-21)30-23-15-8-9-16-28-23/h5-7,11-12,21-23H,8-10,13-19H2,1-4H3/t21-,22+,23?,26?/m1/s1 |
| InChIKey | DWEFZLPZSKHBIE-SUBOJIPVSA-N |
| XLogP | 5.45 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 2-methyl-2-[[(1R,3S)-3-(oxan-2-yloxy)cyclohexyl]methoxy]-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-methyl-2-[[(1R,3S)-3-(oxan-2-yloxy)cyclohexyl]methoxy]-3-phenylpropanoate?
The IUPAC name of tert-butyl 2-methyl-2-[[(1R,3S)-3-(oxan-2-yloxy)cyclohexyl]methoxy]-3-phenylpropanoate (CID 58951521) is tert-butyl 2-methyl-2-[[(1R,3S)-3-(oxan-2-yloxy)cyclohexyl]methoxy]-3-phenylpropanoate.
What is the SMILES notation for tert-butyl 2-methyl-2-[[(1R,3S)-3-(oxan-2-yloxy)cyclohexyl]methoxy]-3-phenylpropanoate?
The canonical SMILES for tert-butyl 2-methyl-2-[[(1R,3S)-3-(oxan-2-yloxy)cyclohexyl]methoxy]-3-phenylpropanoate is CC(C)(C)OC(=O)C(C)(Cc1ccccc1)OC[C@@H]1CCC[C@H](OC2CCCCO2)C1.
What is the InChIKey of tert-butyl 2-methyl-2-[[(1R,3S)-3-(oxan-2-yloxy)cyclohexyl]methoxy]-3-phenylpropanoate?
The InChIKey is DWEFZLPZSKHBIE-SUBOJIPVSA-N. The full InChI is InChI=1S/C26H40O5/c1-25(2,3)31-24(27)26(4,18-20-11-6-5-7-12-20)29-19-21-13-10-14-22(17-21)30-23-15-8-9-16-28-23/h5-7,11-12,21-23H,8-10,13-19H2,1-4H3/t21-,22+,23?,26?/m1/s1.
What are the key properties of tert-butyl 2-methyl-2-[[(1R,3S)-3-(oxan-2-yloxy)cyclohexyl]methoxy]-3-phenylpropanoate?
tert-butyl 2-methyl-2-[[(1R,3S)-3-(oxan-2-yloxy)cyclohexyl]methoxy]-3-phenylpropanoate has a molecular weight of 432.60 g/mol, XLogP of 5.45, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-methyl-2-[[(1R,3S)-3-(oxan-2-yloxy)cyclohexyl]methoxy]-3-phenylpropanoate is sourced from PubChem (CID 58951521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).