About cis-propan-2-yl (1R,3S)-3-(oxan-2-yloxy)cyclohexane-1-carboxylate
cis-propan-2-yl (1R,3S)-3-(oxan-2-yloxy)cyclohexane-1-carboxylate (PubChem CID 58951526) has the molecular formula C15H26O4
and a molecular weight of 270.37 g/mol. Its IUPAC name is cis-propan-2-yl (1R,3S)-3-(oxan-2-yloxy)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | cis-propan-2-yl (1R,3S)-3-(oxan-2-yloxy)cyclohexane-1-carboxylate |
| PubChem CID | 58951526 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | cis-propan-2-yl (1R,3S)-3-(oxan-2-yloxy)cyclohexane-1-carboxylate |
| SMILES | CC(C)OC(=O)[C@@H]1CCC[C@H](OC2CCCCO2)C1 |
| InChI | InChI=1S/C15H26O4/c1-11(2)18-15(16)12-6-5-7-13(10-12)19-14-8-3-4-9-17-14/h11-14H,3-10H2,1-2H3/t12-,13+,14?/m1/s1 |
| InChIKey | ZENSPEQKQUVYEI-AMIUJLCOSA-N |
| XLogP | 3.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cis-propan-2-yl (1R,3S)-3-(oxan-2-yloxy)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-propan-2-yl (1R,3S)-3-(oxan-2-yloxy)cyclohexane-1-carboxylate?
The IUPAC name of cis-propan-2-yl (1R,3S)-3-(oxan-2-yloxy)cyclohexane-1-carboxylate (CID 58951526) is cis-propan-2-yl (1R,3S)-3-(oxan-2-yloxy)cyclohexane-1-carboxylate.
What is the SMILES notation for cis-propan-2-yl (1R,3S)-3-(oxan-2-yloxy)cyclohexane-1-carboxylate?
The canonical SMILES for cis-propan-2-yl (1R,3S)-3-(oxan-2-yloxy)cyclohexane-1-carboxylate is CC(C)OC(=O)[C@@H]1CCC[C@H](OC2CCCCO2)C1.
What is the InChIKey of cis-propan-2-yl (1R,3S)-3-(oxan-2-yloxy)cyclohexane-1-carboxylate?
The InChIKey is ZENSPEQKQUVYEI-AMIUJLCOSA-N. The full InChI is InChI=1S/C15H26O4/c1-11(2)18-15(16)12-6-5-7-13(10-12)19-14-8-3-4-9-17-14/h11-14H,3-10H2,1-2H3/t12-,13+,14?/m1/s1.
What are the key properties of cis-propan-2-yl (1R,3S)-3-(oxan-2-yloxy)cyclohexane-1-carboxylate?
cis-propan-2-yl (1R,3S)-3-(oxan-2-yloxy)cyclohexane-1-carboxylate has a molecular weight of 270.37 g/mol, XLogP of 3.04, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-propan-2-yl (1R,3S)-3-(oxan-2-yloxy)cyclohexane-1-carboxylate is sourced from PubChem (CID 58951526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).