About 1,3-dicyclopropyl-2-(2,2-dibromoethenyl)benzene
1,3-dicyclopropyl-2-(2,2-dibromoethenyl)benzene (PubChem CID 58951765) has the molecular formula C14H14Br2
and a molecular weight of 342.07 g/mol. Its IUPAC name is 1,3-dicyclopropyl-2-(2,2-dibromoethenyl)benzene.
Molecular Properties
| Compound Name | 1,3-dicyclopropyl-2-(2,2-dibromoethenyl)benzene |
| PubChem CID | 58951765 |
| Molecular Formula | C14H14Br2 |
| Molecular Weight | 342.07 g/mol |
| Exact Mass | 339.95 |
| IUPAC Name | 1,3-dicyclopropyl-2-(2,2-dibromoethenyl)benzene |
| SMILES | BrC(Br)=Cc1c(C2CC2)cccc1C1CC1 |
| InChI | InChI=1S/C14H14Br2/c15-14(16)8-13-11(9-4-5-9)2-1-3-12(13)10-6-7-10/h1-3,8-10H,4-7H2 |
| InChIKey | OIQJOXSLPOKEDY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.07 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,3-dicyclopropyl-2-(2,2-dibromoethenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dicyclopropyl-2-(2,2-dibromoethenyl)benzene?
The IUPAC name of 1,3-dicyclopropyl-2-(2,2-dibromoethenyl)benzene (CID 58951765) is 1,3-dicyclopropyl-2-(2,2-dibromoethenyl)benzene.
What is the SMILES notation for 1,3-dicyclopropyl-2-(2,2-dibromoethenyl)benzene?
The canonical SMILES for 1,3-dicyclopropyl-2-(2,2-dibromoethenyl)benzene is BrC(Br)=Cc1c(C2CC2)cccc1C1CC1.
What is the InChIKey of 1,3-dicyclopropyl-2-(2,2-dibromoethenyl)benzene?
The InChIKey is OIQJOXSLPOKEDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14Br2/c15-14(16)8-13-11(9-4-5-9)2-1-3-12(13)10-6-7-10/h1-3,8-10H,4-7H2.
What are the key properties of 1,3-dicyclopropyl-2-(2,2-dibromoethenyl)benzene?
1,3-dicyclopropyl-2-(2,2-dibromoethenyl)benzene has a molecular weight of 342.07 g/mol, XLogP of 5.53, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dicyclopropyl-2-(2,2-dibromoethenyl)benzene is sourced from PubChem (CID 58951765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).