C21H20ClF2NO2 — CID 58952079
tert-butyl N-[3-(4-chlorophenyl)prop-2-ynyl]-N-[(3,4-difluorophenyl)methyl]carbamate (PubChem CID 58952079) has the molecular formula C21H20ClF2NO2 and a molecular weight of 391.85 g/mol. Its IUPAC name is tert-butyl N-[3-(4-chlorophenyl)prop-2-ynyl]-N-[(3,4-difluorophenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-chlorophenyl)prop-2-ynyl]-N-[(3,4-difluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 58952079 |
| Molecular Formula | C21H20ClF2NO2 |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | tert-butyl N-[3-(4-chlorophenyl)prop-2-ynyl]-N-[(3,4-difluorophenyl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CC#Cc1ccc(Cl)cc1)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H20ClF2NO2/c1-21(2,3)27-20(26)25(14-16-8-11-18(23)19(24)13-16)12-4-5-15-6-9-17(22)10-7-15/h6-11,13H,12,14H2,1-3H3 |
| InChIKey | MPIWNNOQGBUYON-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|