C22H22Cl3NO — CID 58952097
(3R,3aS,4S,5R,7aR)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3,7a-dimethyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one (PubChem CID 58952097) has the molecular formula C22H22Cl3NO and a molecular weight of 422.78 g/mol. Its IUPAC name is (3R,3aS,4S,5R,7aR)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3,7a-dimethyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one.
| Compound Name | (3R,3aS,4S,5R,7aR)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3,7a-dimethyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one |
|---|---|
| PubChem CID | 58952097 |
| Molecular Formula | C22H22Cl3NO |
| Molecular Weight | 422.78 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | (3R,3aS,4S,5R,7aR)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3,7a-dimethyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one |
| SMILES | C[C@H]1NC(=O)[C@]2(C)CC[C@@H](c3ccc(Cl)cc3Cl)[C@H](c3ccc(Cl)cc3)[C@H]12 |
| InChI | InChI=1S/C22H22Cl3NO/c1-12-20-19(13-3-5-14(23)6-4-13)17(9-10-22(20,2)21(27)26-12)16-8-7-15(24)11-18(16)25/h3-8,11-12,17,19-20H,9-10H2,1-2H3,(H,26,27)/t12-,17+,19+,20+,22-/m1/s1 |
| InChIKey | IULCKLZUEAJXAT-DTMRDQARSA-N |
| XLogP | 6.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.78 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |