C16H25NO3 — CID 58952164
tert-butyl (3aR,6S,7S,7aS)-4,6,7-trimethyl-3-oxo-3a,6,7,7a-tetrahydro-1H-isoindole-2-carboxylate (PubChem CID 58952164) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is tert-butyl (3aR,6S,7S,7aS)-4,6,7-trimethyl-3-oxo-3a,6,7,7a-tetrahydro-1H-isoindole-2-carboxylate.
| Compound Name | tert-butyl (3aR,6S,7S,7aS)-4,6,7-trimethyl-3-oxo-3a,6,7,7a-tetrahydro-1H-isoindole-2-carboxylate |
|---|---|
| PubChem CID | 58952164 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | tert-butyl (3aR,6S,7S,7aS)-4,6,7-trimethyl-3-oxo-3a,6,7,7a-tetrahydro-1H-isoindole-2-carboxylate |
| SMILES | CC1=C[C@@H](C)[C@H](C)[C@@H]2CN(C(=O)OC(C)(C)C)C(=O)[C@@H]12 |
| InChI | InChI=1S/C16H25NO3/c1-9-7-10(2)13-12(11(9)3)8-17(14(13)18)15(19)20-16(4,5)6/h7,9,11-13H,8H2,1-6H3/t9-,11+,12+,13+/m1/s1 |
| InChIKey | CDMDMKOBYCZYOO-IXOXFDKPSA-N |
| XLogP | 3.23 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|