C23H22Cl3NO2 — CID 58952305
(3R,3aS,4S,5R,7aR)-7a-acetyl-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3-methyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one (PubChem CID 58952305) has the molecular formula C23H22Cl3NO2 and a molecular weight of 450.79 g/mol. Its IUPAC name is (3R,3aS,4S,5R,7aR)-7a-acetyl-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3-methyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one.
| Compound Name | (3R,3aS,4S,5R,7aR)-7a-acetyl-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3-methyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one |
|---|---|
| PubChem CID | 58952305 |
| Molecular Formula | C23H22Cl3NO2 |
| Molecular Weight | 450.79 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | (3R,3aS,4S,5R,7aR)-7a-acetyl-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3-methyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one |
| SMILES | CC(=O)[C@@]12CC[C@@H](c3ccc(Cl)cc3Cl)[C@H](c3ccc(Cl)cc3)[C@@H]1[C@@H](C)NC2=O |
| InChI | InChI=1S/C23H22Cl3NO2/c1-12-21-20(14-3-5-15(24)6-4-14)18(17-8-7-16(25)11-19(17)26)9-10-23(21,13(2)28)22(29)27-12/h3-8,11-12,18,20-21H,9-10H2,1-2H3,(H,27,29)/t12-,18+,20+,21+,23+/m1/s1 |
| InChIKey | KGZVUHXTJGOOLR-UZPOUNLXSA-N |
| XLogP | 6.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.79 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|