C24H24Cl3NO — CID 58952381
(3R,3aS,4S,5R,7aR)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3,7a-diethyl-3,3a,4,5-tetrahydro-2H-isoindol-1-one (PubChem CID 58952381) has the molecular formula C24H24Cl3NO and a molecular weight of 448.82 g/mol. Its IUPAC name is (3R,3aS,4S,5R,7aR)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3,7a-diethyl-3,3a,4,5-tetrahydro-2H-isoindol-1-one.
| Compound Name | (3R,3aS,4S,5R,7aR)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3,7a-diethyl-3,3a,4,5-tetrahydro-2H-isoindol-1-one |
|---|---|
| PubChem CID | 58952381 |
| Molecular Formula | C24H24Cl3NO |
| Molecular Weight | 448.82 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | (3R,3aS,4S,5R,7aR)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3,7a-diethyl-3,3a,4,5-tetrahydro-2H-isoindol-1-one |
| SMILES | CC[C@H]1NC(=O)[C@]2(CC)C=C[C@@H](c3ccc(Cl)cc3Cl)[C@H](c3ccc(Cl)cc3)[C@H]12 |
| InChI | InChI=1S/C24H24Cl3NO/c1-3-20-22-21(14-5-7-15(25)8-6-14)18(17-10-9-16(26)13-19(17)27)11-12-24(22,4-2)23(29)28-20/h5-13,18,20-22H,3-4H2,1-2H3,(H,28,29)/t18-,20+,21-,22-,24+/m0/s1 |
| InChIKey | GIJDJRIYKURXLS-RFFFMIPGSA-N |
| XLogP | 7.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.82 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|