C9H16N2O — CID 58952399
4,5-dimethyl-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-one (PubChem CID 58952399) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 4,5-dimethyl-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-one.
| Compound Name | 4,5-dimethyl-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 58952399 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 4,5-dimethyl-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-one |
| SMILES | CC1CCC2NC(=O)NC2C1C |
| InChI | InChI=1S/C9H16N2O/c1-5-3-4-7-8(6(5)2)11-9(12)10-7/h5-8H,3-4H2,1-2H3,(H2,10,11,12) |
| InChIKey | PUVRDXNQVCULEQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |