C21H19Cl2NO3 — CID 58952448
(3aR,4S,5R,7aS)-5-(2-chloro-4-methoxyphenyl)-4-(4-chlorophenyl)-7a-hydroxy-3,3a,4,5-tetrahydro-2H-isoindol-1-one (PubChem CID 58952448) has the molecular formula C21H19Cl2NO3 and a molecular weight of 404.29 g/mol. Its IUPAC name is (3aR,4S,5R,7aS)-5-(2-chloro-4-methoxyphenyl)-4-(4-chlorophenyl)-7a-hydroxy-3,3a,4,5-tetrahydro-2H-isoindol-1-one.
| Compound Name | (3aR,4S,5R,7aS)-5-(2-chloro-4-methoxyphenyl)-4-(4-chlorophenyl)-7a-hydroxy-3,3a,4,5-tetrahydro-2H-isoindol-1-one |
|---|---|
| PubChem CID | 58952448 |
| Molecular Formula | C21H19Cl2NO3 |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | (3aR,4S,5R,7aS)-5-(2-chloro-4-methoxyphenyl)-4-(4-chlorophenyl)-7a-hydroxy-3,3a,4,5-tetrahydro-2H-isoindol-1-one |
| SMILES | COc1ccc([C@@H]2C=C[C@@]3(O)C(=O)NC[C@H]3[C@H]2c2ccc(Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C21H19Cl2NO3/c1-27-14-6-7-15(18(23)10-14)16-8-9-21(26)17(11-24-20(21)25)19(16)12-2-4-13(22)5-3-12/h2-10,16-17,19,26H,11H2,1H3,(H,24,25)/t16-,17-,19-,21-/m0/s1 |
| InChIKey | YKSLFMLADFSZSR-VKRLORBYSA-N |
| XLogP | 3.92 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|