C23H24Cl2FNO — CID 58952479
(3R,3aS,4S,5R,7aR)-5-(2-chloro-4-fluorophenyl)-4-(4-chlorophenyl)-7a-ethyl-3-methyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one (PubChem CID 58952479) has the molecular formula C23H24Cl2FNO and a molecular weight of 420.36 g/mol. Its IUPAC name is (3R,3aS,4S,5R,7aR)-5-(2-chloro-4-fluorophenyl)-4-(4-chlorophenyl)-7a-ethyl-3-methyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one.
| Compound Name | (3R,3aS,4S,5R,7aR)-5-(2-chloro-4-fluorophenyl)-4-(4-chlorophenyl)-7a-ethyl-3-methyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one |
|---|---|
| PubChem CID | 58952479 |
| Molecular Formula | C23H24Cl2FNO |
| Molecular Weight | 420.36 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | (3R,3aS,4S,5R,7aR)-5-(2-chloro-4-fluorophenyl)-4-(4-chlorophenyl)-7a-ethyl-3-methyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one |
| SMILES | CC[C@@]12CC[C@@H](c3ccc(F)cc3Cl)[C@H](c3ccc(Cl)cc3)[C@@H]1[C@@H](C)NC2=O |
| InChI | InChI=1S/C23H24Cl2FNO/c1-3-23-11-10-18(17-9-8-16(26)12-19(17)25)20(14-4-6-15(24)7-5-14)21(23)13(2)27-22(23)28/h4-9,12-13,18,20-21H,3,10-11H2,1-2H3,(H,27,28)/t13-,18+,20+,21+,23-/m1/s1 |
| InChIKey | OZDMVSVIFKIZBO-LNAXAKQZSA-N |
| XLogP | 6.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.36 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |