C29H25Cl3N2O — CID 58952521
(3R,3aS,4S,5R,7aS)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-7a-[(3-isocyanophenyl)methyl]-3-methyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one (PubChem CID 58952521) has the molecular formula C29H25Cl3N2O and a molecular weight of 523.89 g/mol. Its IUPAC name is (3R,3aS,4S,5R,7aS)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-7a-[(3-isocyanophenyl)methyl]-3-methyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one.
| Compound Name | (3R,3aS,4S,5R,7aS)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-7a-[(3-isocyanophenyl)methyl]-3-methyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one |
|---|---|
| PubChem CID | 58952521 |
| Molecular Formula | C29H25Cl3N2O |
| Molecular Weight | 523.89 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | (3R,3aS,4S,5R,7aS)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-7a-[(3-isocyanophenyl)methyl]-3-methyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one |
| SMILES | [C-]#[N+]c1cccc(C[C@@]23CC[C@@H](c4ccc(Cl)cc4Cl)[C@H](c4ccc(Cl)cc4)[C@@H]2[C@@H](C)NC3=O)c1 |
| InChI | InChI=1S/C29H25Cl3N2O/c1-17-27-26(19-6-8-20(30)9-7-19)24(23-11-10-21(31)15-25(23)32)12-13-29(27,28(35)34-17)16-18-4-3-5-22(14-18)33-2/h3-11,14-15,17,24,26-27H,12-13,16H2,1H3,(H,34,35)/t17-,24+,26+,27+,29+/m1/s1 |
| InChIKey | CSBXTGCYJHDPHC-IFHGFGJHSA-N |
| XLogP | 8.22 |
| TPSA | 33.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.89 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|