C13H13Cl3N2O2 — CID 58952589
N-[2-(4,6,7-trichloro-5-methoxy-1H-indol-3-yl)ethyl]acetamide (PubChem CID 58952589) has the molecular formula C13H13Cl3N2O2 and a molecular weight of 335.62 g/mol. Its IUPAC name is N-[2-(4,6,7-trichloro-5-methoxy-1H-indol-3-yl)ethyl]acetamide.
| Compound Name | N-[2-(4,6,7-trichloro-5-methoxy-1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 58952589 |
| Molecular Formula | C13H13Cl3N2O2 |
| Molecular Weight | 335.62 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | N-[2-(4,6,7-trichloro-5-methoxy-1H-indol-3-yl)ethyl]acetamide |
| SMILES | COc1c(Cl)c(Cl)c2[nH]cc(CCNC(C)=O)c2c1Cl |
| InChI | InChI=1S/C13H13Cl3N2O2/c1-6(19)17-4-3-7-5-18-12-8(7)9(14)13(20-2)11(16)10(12)15/h5,18H,3-4H2,1-2H3,(H,17,19) |
| InChIKey | PSEIWWSDBWHZTK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.62 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|