C26H40O5Si — CID 58952615
2'-[(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-3-oxocyclopentyl]spiro[1,3-dioxolane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-1'-carbaldehyde (PubChem CID 58952615) has the molecular formula C26H40O5Si and a molecular weight of 460.69 g/mol. Its IUPAC name is 2'-[(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-3-oxocyclopentyl]spiro[1,3-dioxolane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-1'-carbaldehyde.
| Compound Name | 2'-[(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-3-oxocyclopentyl]spiro[1,3-dioxolane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-1'-carbaldehyde |
|---|---|
| PubChem CID | 58952615 |
| Molecular Formula | C26H40O5Si |
| Molecular Weight | 460.69 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 2'-[(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-3-oxocyclopentyl]spiro[1,3-dioxolane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-1'-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@]1(C)C(=O)CCC1C1CCC2=CC3(CCC2=C1C=O)OCCO3 |
| InChI | InChI=1S/C26H40O5Si/c1-24(2,3)32(5,6)31-17-25(4)22(9-10-23(25)28)20-8-7-18-15-26(29-13-14-30-26)12-11-19(18)21(20)16-27/h15-16,20,22H,7-14,17H2,1-6H3/t20?,22?,25-/m0/s1 |
| InChIKey | LVIPKCFLGUTKLY-YNJPUODISA-N |
| XLogP | 5.36 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.69 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|