C25H28O3S — CID 58952620
(6R,9R)-6-methyl-9-(4-methylsulfanylphenyl)-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-diene-5,14-dione (PubChem CID 58952620) has the molecular formula C25H28O3S and a molecular weight of 408.56 g/mol. Its IUPAC name is (6R,9R)-6-methyl-9-(4-methylsulfanylphenyl)-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-diene-5,14-dione.
| Compound Name | (6R,9R)-6-methyl-9-(4-methylsulfanylphenyl)-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-diene-5,14-dione |
|---|---|
| PubChem CID | 58952620 |
| Molecular Formula | C25H28O3S |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | (6R,9R)-6-methyl-9-(4-methylsulfanylphenyl)-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-diene-5,14-dione |
| SMILES | CSc1ccc([C@H]2OC[C@]3(C)C(=O)CCC3C3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C25H28O3S/c1-25-14-28-24(15-3-7-18(29-2)8-4-15)23-19-10-6-17(26)13-16(19)5-9-20(23)21(25)11-12-22(25)27/h3-4,7-8,13,20-21,24H,5-6,9-12,14H2,1-2H3/t20?,21?,24-,25+/m1/s1 |
| InChIKey | AXQTWWASGQGMOP-GBBDAIBUSA-N |
| XLogP | 5.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |